C24H31N3O3 — CID 54824667
3-[[2-(2-prop-2-enoxyanilino)acetyl]amino]-N,N-dipropylbenzamide (PubChem CID 54824667) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-[[2-(2-prop-2-enoxyanilino)acetyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 3-[[2-(2-prop-2-enoxyanilino)acetyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 54824667 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 3-[[2-(2-prop-2-enoxyanilino)acetyl]amino]-N,N-dipropylbenzamide |
| SMILES | C=CCOc1ccccc1NCC(=O)Nc1cccc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C24H31N3O3/c1-4-14-27(15-5-2)24(29)19-10-9-11-20(17-19)26-23(28)18-25-21-12-7-8-13-22(21)30-16-6-3/h6-13,17,25H,3-5,14-16,18H2,1-2H3,(H,26,28) |
| InChIKey | QMVZSKGKHLRIIE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|