C25H35N3O4 — CID 54827668
3-[[2-[2-(2-ethoxyethoxy)anilino]acetyl]amino]-N,N-dipropylbenzamide (PubChem CID 54827668) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is 3-[[2-[2-(2-ethoxyethoxy)anilino]acetyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 3-[[2-[2-(2-ethoxyethoxy)anilino]acetyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 54827668 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 3-[[2-[2-(2-ethoxyethoxy)anilino]acetyl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(NC(=O)CNc2ccccc2OCCOCC)c1 |
| InChI | InChI=1S/C25H35N3O4/c1-4-14-28(15-5-2)25(30)20-10-9-11-21(18-20)27-24(29)19-26-22-12-7-8-13-23(22)32-17-16-31-6-3/h7-13,18,26H,4-6,14-17,19H2,1-3H3,(H,27,29) |
| InChIKey | QBXNBQJOWBDOGG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|