C18H23N3O3 — CID 54834417
3-[[2-(butylamino)-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 54834417) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[[2-(butylamino)-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-(butylamino)-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54834417 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[[2-(butylamino)-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CCCCNC(=O)CNc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-2-3-9-19-17(22)13-20-15-7-4-6-14(11-15)18(23)21-12-16-8-5-10-24-16/h4-8,10-11,20H,2-3,9,12-13H2,1H3,(H,19,22)(H,21,23) |
| InChIKey | KDIIRIZOYBJCCF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|