C29H28N4O4 — CID 54834724
3-[[2-[3-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 54834724) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 3-[[2-[3-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-[3-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54834724 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 3-[[2-[3-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CCN(C(=O)c1cccc(NC(=O)CNc2cccc(C(=O)NCc3ccco3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C29H28N4O4/c1-2-33(25-13-4-3-5-14-25)29(36)22-10-7-12-24(18-22)32-27(34)20-30-23-11-6-9-21(17-23)28(35)31-19-26-15-8-16-37-26/h3-18,30H,2,19-20H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | GQXJRXHBNSMYFH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |