C21H31N3O2 — CID 54845679
3-[3-[[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]amino]phenyl]-N,N-dimethylpropanamide (PubChem CID 54845679) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-[3-[[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]amino]phenyl]-N,N-dimethylpropanamide.
| Compound Name | 3-[3-[[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]amino]phenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 54845679 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 3-[3-[[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]amino]phenyl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCc1cccc(NCC(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C21H31N3O2/c1-24(2)21(26)12-11-18-9-6-10-19(15-18)23-16-20(25)22-14-13-17-7-4-3-5-8-17/h6-7,9-10,15,23H,3-5,8,11-14,16H2,1-2H3,(H,22,25) |
| InChIKey | VDJUPEQBWWVWCZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|