C23H36N2O2 — CID 54829291
N-[2-(cyclohexen-1-yl)ethyl]-2-(3-heptoxyanilino)acetamide (PubChem CID 54829291) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(3-heptoxyanilino)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(3-heptoxyanilino)acetamide |
|---|---|
| PubChem CID | 54829291 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(3-heptoxyanilino)acetamide |
| SMILES | CCCCCCCOc1cccc(NCC(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C23H36N2O2/c1-2-3-4-5-9-17-27-22-14-10-13-21(18-22)25-19-23(26)24-16-15-20-11-7-6-8-12-20/h10-11,13-14,18,25H,2-9,12,15-17,19H2,1H3,(H,24,26) |
| InChIKey | CFQCTFIWLREWKX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|