C15H17BrN4O3 — CID 54850545
2-amino-4-[3-bromo-4-(2-methoxyethoxy)phenyl]-6-methylpyrimidine-5-carboxamide (PubChem CID 54850545) has the molecular formula C15H17BrN4O3 and a molecular weight of 381.23 g/mol. Its IUPAC name is 2-amino-4-[3-bromo-4-(2-methoxyethoxy)phenyl]-6-methylpyrimidine-5-carboxamide.
| Compound Name | 2-amino-4-[3-bromo-4-(2-methoxyethoxy)phenyl]-6-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 54850545 |
| Molecular Formula | C15H17BrN4O3 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-amino-4-[3-bromo-4-(2-methoxyethoxy)phenyl]-6-methylpyrimidine-5-carboxamide |
| SMILES | COCCOc1ccc(-c2nc(N)nc(C)c2C(N)=O)cc1Br |
| InChI | InChI=1S/C15H17BrN4O3/c1-8-12(14(17)21)13(20-15(18)19-8)9-3-4-11(10(16)7-9)23-6-5-22-2/h3-4,7H,5-6H2,1-2H3,(H2,17,21)(H2,18,19,20) |
| InChIKey | SPYZRAQHBPKUFM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|