C17H21BrN4O2 — CID 54851170
2-amino-4-[(2-bromo-4-tert-butylphenoxy)methyl]-6-methylpyrimidine-5-carboxamide (PubChem CID 54851170) has the molecular formula C17H21BrN4O2 and a molecular weight of 393.29 g/mol. Its IUPAC name is 2-amino-4-[(2-bromo-4-tert-butylphenoxy)methyl]-6-methylpyrimidine-5-carboxamide.
| Compound Name | 2-amino-4-[(2-bromo-4-tert-butylphenoxy)methyl]-6-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 54851170 |
| Molecular Formula | C17H21BrN4O2 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-amino-4-[(2-bromo-4-tert-butylphenoxy)methyl]-6-methylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(N)nc(COc2ccc(C(C)(C)C)cc2Br)c1C(N)=O |
| InChI | InChI=1S/C17H21BrN4O2/c1-9-14(15(19)23)12(22-16(20)21-9)8-24-13-6-5-10(7-11(13)18)17(2,3)4/h5-7H,8H2,1-4H3,(H2,19,23)(H2,20,21,22) |
| InChIKey | LHYOTRZWAAIMIA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |