C13H13Cl2N5O2 — CID 54851529
2-amino-4-[(2,4-dichlorophenoxy)methyl]-6-methylpyrimidine-5-carbohydrazide (PubChem CID 54851529) has the molecular formula C13H13Cl2N5O2 and a molecular weight of 342.19 g/mol. Its IUPAC name is 2-amino-4-[(2,4-dichlorophenoxy)methyl]-6-methylpyrimidine-5-carbohydrazide.
| Compound Name | 2-amino-4-[(2,4-dichlorophenoxy)methyl]-6-methylpyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 54851529 |
| Molecular Formula | C13H13Cl2N5O2 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-amino-4-[(2,4-dichlorophenoxy)methyl]-6-methylpyrimidine-5-carbohydrazide |
| SMILES | Cc1nc(N)nc(COc2ccc(Cl)cc2Cl)c1C(=O)NN |
| InChI | InChI=1S/C13H13Cl2N5O2/c1-6-11(12(21)20-17)9(19-13(16)18-6)5-22-10-3-2-7(14)4-8(10)15/h2-4H,5,17H2,1H3,(H,20,21)(H2,16,18,19) |
| InChIKey | ORCOWKUXCJLPOS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|