C14H17BrN4O2 — CID 54851541
3-[(4-bromo-2,6-dimethylphenoxy)methyl]-5-methyl-1H-pyrazole-4-carbohydrazide (PubChem CID 54851541) has the molecular formula C14H17BrN4O2 and a molecular weight of 353.22 g/mol. Its IUPAC name is 3-[(4-bromo-2,6-dimethylphenoxy)methyl]-5-methyl-1H-pyrazole-4-carbohydrazide.
| Compound Name | 3-[(4-bromo-2,6-dimethylphenoxy)methyl]-5-methyl-1H-pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 54851541 |
| Molecular Formula | C14H17BrN4O2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 3-[(4-bromo-2,6-dimethylphenoxy)methyl]-5-methyl-1H-pyrazole-4-carbohydrazide |
| SMILES | Cc1cc(Br)cc(C)c1OCc1n[nH]c(C)c1C(=O)NN |
| InChI | InChI=1S/C14H17BrN4O2/c1-7-4-10(15)5-8(2)13(7)21-6-11-12(14(20)17-16)9(3)18-19-11/h4-5H,6,16H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | KBAAQXLCTTWOQG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|