C20H30N4O2 — CID 54850676
3-[(2,4-ditert-butylphenoxy)methyl]-5-methyl-1H-pyrazole-4-carbohydrazide (PubChem CID 54850676) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[(2,4-ditert-butylphenoxy)methyl]-5-methyl-1H-pyrazole-4-carbohydrazide.
| Compound Name | 3-[(2,4-ditert-butylphenoxy)methyl]-5-methyl-1H-pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 54850676 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 3-[(2,4-ditert-butylphenoxy)methyl]-5-methyl-1H-pyrazole-4-carbohydrazide |
| SMILES | Cc1[nH]nc(COc2ccc(C(C)(C)C)cc2C(C)(C)C)c1C(=O)NN |
| InChI | InChI=1S/C20H30N4O2/c1-12-17(18(25)22-21)15(24-23-12)11-26-16-9-8-13(19(2,3)4)10-14(16)20(5,6)7/h8-10H,11,21H2,1-7H3,(H,22,25)(H,23,24) |
| InChIKey | LKTGUCUXDCHVSY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|