C17H25N3O2 — CID 170565333
3-[(2,4-ditert-butylphenoxy)methyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 170565333) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-[(2,4-ditert-butylphenoxy)methyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[(2,4-ditert-butylphenoxy)methyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 170565333 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 3-[(2,4-ditert-butylphenoxy)methyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CC(C)(C)c1ccc(OCc2n[nH]c(=O)[nH]2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-16(2,3)11-7-8-13(12(9-11)17(4,5)6)22-10-14-18-15(21)20-19-14/h7-9H,10H2,1-6H3,(H2,18,19,20,21) |
| InChIKey | ALHJHMPUZCVCFY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |