C17H25N3OS — CID 7139278
5-[(2,4-ditert-butylphenoxy)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 7139278) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is 5-[(2,4-ditert-butylphenoxy)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(2,4-ditert-butylphenoxy)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 7139278 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 5-[(2,4-ditert-butylphenoxy)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)(C)c1ccc(OCc2nnc(N)s2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H25N3OS/c1-16(2,3)11-7-8-13(12(9-11)17(4,5)6)21-10-14-19-20-15(18)22-14/h7-9H,10H2,1-6H3,(H2,18,20) |
| InChIKey | HXYULYLRFODXMS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |