C19H24ClNO4 — CID 54855853
N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-1-[3-(2-methoxyethoxy)phenyl]methanamine (PubChem CID 54855853) has the molecular formula C19H24ClNO4 and a molecular weight of 365.86 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-1-[3-(2-methoxyethoxy)phenyl]methanamine.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-1-[3-(2-methoxyethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 54855853 |
| Molecular Formula | C19H24ClNO4 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-1-[3-(2-methoxyethoxy)phenyl]methanamine |
| SMILES | COCCOc1cccc(CNCc2cc(OC)c(OC)cc2Cl)c1 |
| InChI | InChI=1S/C19H24ClNO4/c1-22-7-8-25-16-6-4-5-14(9-16)12-21-13-15-10-18(23-2)19(24-3)11-17(15)20/h4-6,9-11,21H,7-8,12-13H2,1-3H3 |
| InChIKey | LHQKOGQKUPBJHV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|