C24H43N3O2 — CID 54856337
3-[4-[(2,4-dipentoxyphenyl)methyl]piperazin-1-yl]propan-1-amine (PubChem CID 54856337) has the molecular formula C24H43N3O2 and a molecular weight of 405.63 g/mol. Its IUPAC name is 3-[4-[(2,4-dipentoxyphenyl)methyl]piperazin-1-yl]propan-1-amine.
| Compound Name | 3-[4-[(2,4-dipentoxyphenyl)methyl]piperazin-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 54856337 |
| Molecular Formula | C24H43N3O2 |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.34 |
| IUPAC Name | 3-[4-[(2,4-dipentoxyphenyl)methyl]piperazin-1-yl]propan-1-amine |
| SMILES | CCCCCOc1ccc(CN2CCN(CCCN)CC2)c(OCCCCC)c1 |
| InChI | InChI=1S/C24H43N3O2/c1-3-5-7-18-28-23-11-10-22(24(20-23)29-19-8-6-4-2)21-27-16-14-26(15-17-27)13-9-12-25/h10-11,20H,3-9,12-19,21,25H2,1-2H3 |
| InChIKey | GQLISWLECGWLOK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|