C30H51N3O2 — CID 54856519
3-[4-[(2,4-dioctoxyphenyl)methyl]piperazin-1-yl]propanenitrile (PubChem CID 54856519) has the molecular formula C30H51N3O2 and a molecular weight of 485.76 g/mol. Its IUPAC name is 3-[4-[(2,4-dioctoxyphenyl)methyl]piperazin-1-yl]propanenitrile.
| Compound Name | 3-[4-[(2,4-dioctoxyphenyl)methyl]piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 54856519 |
| Molecular Formula | C30H51N3O2 |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 485.40 |
| IUPAC Name | 3-[4-[(2,4-dioctoxyphenyl)methyl]piperazin-1-yl]propanenitrile |
| SMILES | CCCCCCCCOc1ccc(CN2CCN(CCC#N)CC2)c(OCCCCCCCC)c1 |
| InChI | InChI=1S/C30H51N3O2/c1-3-5-7-9-11-13-24-34-29-17-16-28(27-33-22-20-32(21-23-33)19-15-18-31)30(26-29)35-25-14-12-10-8-6-4-2/h16-17,26H,3-15,19-25,27H2,1-2H3 |
| InChIKey | IJRHOIVTVMXJOJ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|