C22H19N3O2S2 — CID 54859309
N-[[4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 54859309) has the molecular formula C22H19N3O2S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is N-[[4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 54859309 |
| Molecular Formula | C22H19N3O2S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[[4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C)c2oc(Cc3ccc(NC(=S)NC(=O)c4cccs4)cc3)nc2c1 |
| InChI | InChI=1S/C22H19N3O2S2/c1-13-10-14(2)20-17(11-13)24-19(27-20)12-15-5-7-16(8-6-15)23-22(28)25-21(26)18-4-3-9-29-18/h3-11H,12H2,1-2H3,(H2,23,25,26,28) |
| InChIKey | MMJBDSONZGGZMY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|