C22H25N3O2S — CID 54859496
N-[[4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]pentanamide (PubChem CID 54859496) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is N-[[4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]pentanamide.
| Compound Name | N-[[4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 54859496 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[[4-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]pentanamide |
| SMILES | CCCCC(=O)NC(=S)Nc1ccc(Cc2nc3cc(C)cc(C)c3o2)cc1 |
| InChI | InChI=1S/C22H25N3O2S/c1-4-5-6-19(26)25-22(28)23-17-9-7-16(8-10-17)13-20-24-18-12-14(2)11-15(3)21(18)27-20/h7-12H,4-6,13H2,1-3H3,(H2,23,25,26,28) |
| InChIKey | UVYKTAIJMTWODV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|