C20H19Cl2N3O2S — CID 54859557
N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-3-methylbutanamide (PubChem CID 54859557) has the molecular formula C20H19Cl2N3O2S and a molecular weight of 436.36 g/mol. Its IUPAC name is N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-3-methylbutanamide.
| Compound Name | N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 54859557 |
| Molecular Formula | C20H19Cl2N3O2S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(=S)Nc1ccc(Cc2nc3cc(Cl)cc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O2S/c1-11(2)7-17(26)25-20(28)23-14-5-3-12(4-6-14)8-18-24-16-10-13(21)9-15(22)19(16)27-18/h3-6,9-11H,7-8H2,1-2H3,(H2,23,25,26,28) |
| InChIKey | DRAPLUCESOHEFN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|