C23H15Cl4N3O3S — CID 54859926
N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 54859926) has the molecular formula C23H15Cl4N3O3S and a molecular weight of 555.27 g/mol. Its IUPAC name is N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 54859926 |
| Molecular Formula | C23H15Cl4N3O3S |
| Molecular Weight | 555.27 g/mol |
| Exact Mass | 552.96 |
| IUPAC Name | N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NC(=S)Nc1ccc(Cc2nc3cc(Cl)cc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C23H15Cl4N3O3S/c24-13-3-6-19(16(26)8-13)32-11-20(31)30-23(34)28-15-4-1-12(2-5-15)7-21-29-18-10-14(25)9-17(27)22(18)33-21/h1-6,8-10H,7,11H2,(H2,28,30,31,34) |
| InChIKey | FZXRMFHRIZYOOH-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.27 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|