C25H21Cl2N3O3S — CID 54859634
N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-3-propoxybenzamide (PubChem CID 54859634) has the molecular formula C25H21Cl2N3O3S and a molecular weight of 514.43 g/mol. Its IUPAC name is N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-3-propoxybenzamide.
| Compound Name | N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-3-propoxybenzamide |
|---|---|
| PubChem CID | 54859634 |
| Molecular Formula | C25H21Cl2N3O3S |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | N-[[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)NC(=S)Nc2ccc(Cc3nc4cc(Cl)cc(Cl)c4o3)cc2)c1 |
| InChI | InChI=1S/C25H21Cl2N3O3S/c1-2-10-32-19-5-3-4-16(12-19)24(31)30-25(34)28-18-8-6-15(7-9-18)11-22-29-21-14-17(26)13-20(27)23(21)33-22/h3-9,12-14H,2,10-11H2,1H3,(H2,28,30,31,34) |
| InChIKey | NPFRDICITYJFFB-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|