C23H17Cl2N3O3S — CID 54859639
N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-2-(2-chlorophenoxy)acetamide (PubChem CID 54859639) has the molecular formula C23H17Cl2N3O3S and a molecular weight of 486.38 g/mol. Its IUPAC name is N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-2-(2-chlorophenoxy)acetamide.
| Compound Name | N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-2-(2-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 54859639 |
| Molecular Formula | C23H17Cl2N3O3S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-2-(2-chlorophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1Cl)NC(=S)Nc1ccc(Cc2nc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C23H17Cl2N3O3S/c24-15-7-10-20-18(12-15)27-22(31-20)11-14-5-8-16(9-6-14)26-23(32)28-21(29)13-30-19-4-2-1-3-17(19)25/h1-10,12H,11,13H2,(H2,26,28,29,32) |
| InChIKey | KERBYRGUPWJMBM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|