C25H21BrClN3O3S — CID 54859631
2-(2-bromo-4,6-dimethylphenoxy)-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]acetamide (PubChem CID 54859631) has the molecular formula C25H21BrClN3O3S and a molecular weight of 558.89 g/mol. Its IUPAC name is 2-(2-bromo-4,6-dimethylphenoxy)-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(2-bromo-4,6-dimethylphenoxy)-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 54859631 |
| Molecular Formula | C25H21BrClN3O3S |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 557.02 |
| IUPAC Name | 2-(2-bromo-4,6-dimethylphenoxy)-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)NC(=S)Nc2ccc(Cc3nc4cc(Cl)ccc4o3)cc2)c(Br)c1 |
| InChI | InChI=1S/C25H21BrClN3O3S/c1-14-9-15(2)24(19(26)10-14)32-13-22(31)30-25(34)28-18-6-3-16(4-7-18)11-23-29-20-12-17(27)5-8-21(20)33-23/h3-10,12H,11,13H2,1-2H3,(H2,28,30,31,34) |
| InChIKey | RZTVRPJMKPXHCA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|