C14H13N3S — CID 54868733
N-[(2-methyl-1,3-thiazol-5-yl)methyl]quinolin-5-amine (PubChem CID 54868733) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-5-yl)methyl]quinolin-5-amine.
| Compound Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]quinolin-5-amine |
|---|---|
| PubChem CID | 54868733 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]quinolin-5-amine |
| SMILES | Cc1ncc(CNc2cccc3ncccc23)s1 |
| InChI | InChI=1S/C14H13N3S/c1-10-16-8-11(18-10)9-17-14-6-2-5-13-12(14)4-3-7-15-13/h2-8,17H,9H2,1H3 |
| InChIKey | JYRNNTPUGIZTOF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |