C13H11N3S — CID 62758841
N-(1,3-thiazol-5-ylmethyl)quinolin-5-amine (PubChem CID 62758841) has the molecular formula C13H11N3S and a molecular weight of 241.32 g/mol. Its IUPAC name is N-(1,3-thiazol-5-ylmethyl)quinolin-5-amine.
| Compound Name | N-(1,3-thiazol-5-ylmethyl)quinolin-5-amine |
|---|---|
| PubChem CID | 62758841 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-(1,3-thiazol-5-ylmethyl)quinolin-5-amine |
| SMILES | c1cc(NCc2cncs2)c2cccnc2c1 |
| InChI | InChI=1S/C13H11N3S/c1-4-12-11(3-2-6-15-12)13(5-1)16-8-10-7-14-9-17-10/h1-7,9,16H,8H2 |
| InChIKey | WCDLRCNYAHBIEH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |