C10H15ClN2O3S — CID 54877695
3-chloro-N-(1-ethyl-6-oxo-3-pyridinyl)propane-1-sulfonamide (PubChem CID 54877695) has the molecular formula C10H15ClN2O3S and a molecular weight of 278.76 g/mol. Its IUPAC name is 3-chloro-N-(1-ethyl-6-oxo-3-pyridinyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(1-ethyl-6-oxo-3-pyridinyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 54877695 |
| Molecular Formula | C10H15ClN2O3S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 3-chloro-N-(1-ethyl-6-oxo-3-pyridinyl)propane-1-sulfonamide |
| SMILES | CCn1cc(NS(=O)(=O)CCCCl)ccc1=O |
| InChI | InChI=1S/C10H15ClN2O3S/c1-2-13-8-9(4-5-10(13)14)12-17(15,16)7-3-6-11/h4-5,8,12H,2-3,6-7H2,1H3 |
| InChIKey | LUPUAIKHAVHSEU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|