C13H12Br2N2O3S — CID 61216187
2,4-dibromo-N-(1-ethyl-6-oxo-3-pyridinyl)benzenesulfonamide (PubChem CID 61216187) has the molecular formula C13H12Br2N2O3S and a molecular weight of 436.13 g/mol. Its IUPAC name is 2,4-dibromo-N-(1-ethyl-6-oxo-3-pyridinyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(1-ethyl-6-oxo-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61216187 |
| Molecular Formula | C13H12Br2N2O3S |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | 2,4-dibromo-N-(1-ethyl-6-oxo-3-pyridinyl)benzenesulfonamide |
| SMILES | CCn1cc(NS(=O)(=O)c2ccc(Br)cc2Br)ccc1=O |
| InChI | InChI=1S/C13H12Br2N2O3S/c1-2-17-8-10(4-6-13(17)18)16-21(19,20)12-5-3-9(14)7-11(12)15/h3-8,16H,2H2,1H3 |
| InChIKey | LTSSWCPHSHFWOB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |