C9H12N2O5S — CID 60932761
2-[(1-ethyl-6-oxo-3-pyridinyl)sulfamoyl]acetic acid (PubChem CID 60932761) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is 2-[(1-ethyl-6-oxo-3-pyridinyl)sulfamoyl]acetic acid.
| Compound Name | 2-[(1-ethyl-6-oxo-3-pyridinyl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 60932761 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-[(1-ethyl-6-oxo-3-pyridinyl)sulfamoyl]acetic acid |
| SMILES | CCn1cc(NS(=O)(=O)CC(=O)O)ccc1=O |
| InChI | InChI=1S/C9H12N2O5S/c1-2-11-5-7(3-4-8(11)12)10-17(15,16)6-9(13)14/h3-5,10H,2,6H2,1H3,(H,13,14) |
| InChIKey | YTAAUCMSDGLDRB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |