C12H20ClN3O2S — CID 54877697
3-chloro-N-[6-(diethylamino)-3-pyridinyl]propane-1-sulfonamide (PubChem CID 54877697) has the molecular formula C12H20ClN3O2S and a molecular weight of 305.83 g/mol. Its IUPAC name is 3-chloro-N-[6-(diethylamino)-3-pyridinyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[6-(diethylamino)-3-pyridinyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 54877697 |
| Molecular Formula | C12H20ClN3O2S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-chloro-N-[6-(diethylamino)-3-pyridinyl]propane-1-sulfonamide |
| SMILES | CCN(CC)c1ccc(NS(=O)(=O)CCCCl)cn1 |
| InChI | InChI=1S/C12H20ClN3O2S/c1-3-16(4-2)12-7-6-11(10-14-12)15-19(17,18)9-5-8-13/h6-7,10,15H,3-5,8-9H2,1-2H3 |
| InChIKey | IKUJNQCGVAZMBX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|