C16H28N2S — CID 54880288
N'-cyclohexyl-N'-methyl-N-(1-thiophen-2-ylethyl)propane-1,3-diamine (PubChem CID 54880288) has the molecular formula C16H28N2S and a molecular weight of 280.48 g/mol. Its IUPAC name is N'-cyclohexyl-N'-methyl-N-(1-thiophen-2-ylethyl)propane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N'-methyl-N-(1-thiophen-2-ylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 54880288 |
| Molecular Formula | C16H28N2S |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | N'-cyclohexyl-N'-methyl-N-(1-thiophen-2-ylethyl)propane-1,3-diamine |
| SMILES | CC(NCCCN(C)C1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C16H28N2S/c1-14(16-10-6-13-19-16)17-11-7-12-18(2)15-8-4-3-5-9-15/h6,10,13-15,17H,3-5,7-9,11-12H2,1-2H3 |
| InChIKey | KYQHHBNTSPUHTL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|