C17H31N3S — CID 60980294
N'-cyclohexyl-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N'-methylpropane-1,3-diamine (PubChem CID 60980294) has the molecular formula C17H31N3S and a molecular weight of 309.52 g/mol. Its IUPAC name is N'-cyclohexyl-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 60980294 |
| Molecular Formula | C17H31N3S |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | N'-cyclohexyl-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N'-methylpropane-1,3-diamine |
| SMILES | Cc1nc(C(C)NCCCN(C)C2CCCCC2)c(C)s1 |
| InChI | InChI=1S/C17H31N3S/c1-13(17-14(2)21-15(3)19-17)18-11-8-12-20(4)16-9-6-5-7-10-16/h13,16,18H,5-12H2,1-4H3 |
| InChIKey | ASNRGQVCEXJMAI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|