C13H16N4OS — CID 54883436
2-(2-phenylethylsulfanyl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide (PubChem CID 54883436) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 2-(2-phenylethylsulfanyl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide.
| Compound Name | 2-(2-phenylethylsulfanyl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 54883436 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(2-phenylethylsulfanyl)-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide |
| SMILES | O=C(CSCCc1ccccc1)NCc1ncn[nH]1 |
| InChI | InChI=1S/C13H16N4OS/c18-13(14-8-12-15-10-16-17-12)9-19-7-6-11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,14,18)(H,15,16,17) |
| InChIKey | VWEQNOBVOSRGTR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|