C15H19NO3 — CID 54904300
3,3-diethyl-1-[(3-hydroxyphenyl)methyl]pyrrolidine-2,5-dione (PubChem CID 54904300) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3,3-diethyl-1-[(3-hydroxyphenyl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 3,3-diethyl-1-[(3-hydroxyphenyl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 54904300 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 3,3-diethyl-1-[(3-hydroxyphenyl)methyl]pyrrolidine-2,5-dione |
| SMILES | CCC1(CC)CC(=O)N(Cc2cccc(O)c2)C1=O |
| InChI | InChI=1S/C15H19NO3/c1-3-15(4-2)9-13(18)16(14(15)19)10-11-6-5-7-12(17)8-11/h5-8,17H,3-4,9-10H2,1-2H3 |
| InChIKey | ICKSZVJAOAYMPN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|