C16H19N3O2 — CID 115281556
1-(1H-benzimidazol-2-ylmethyl)-3,3-diethylpyrrolidine-2,5-dione (PubChem CID 115281556) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-ylmethyl)-3,3-diethylpyrrolidine-2,5-dione.
| Compound Name | 1-(1H-benzimidazol-2-ylmethyl)-3,3-diethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 115281556 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-(1H-benzimidazol-2-ylmethyl)-3,3-diethylpyrrolidine-2,5-dione |
| SMILES | CCC1(CC)CC(=O)N(Cc2nc3ccccc3[nH]2)C1=O |
| InChI | InChI=1S/C16H19N3O2/c1-3-16(4-2)9-14(20)19(15(16)21)10-13-17-11-7-5-6-8-12(11)18-13/h5-8H,3-4,9-10H2,1-2H3,(H,17,18) |
| InChIKey | OUCHFLDGPKSBQR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|