C30H27BrN3OP — CID 140976509
1-(1H-benzimidazol-2-ylmethyl)-3-[bromo(triphenyl)-λ5-phosphanyl]pyrrolidin-2-one (PubChem CID 140976509) has the molecular formula C30H27BrN3OP and a molecular weight of 556.44 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-ylmethyl)-3-[bromo(triphenyl)-λ5-phosphanyl]pyrrolidin-2-one.
| Compound Name | 1-(1H-benzimidazol-2-ylmethyl)-3-[bromo(triphenyl)-λ5-phosphanyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 140976509 |
| Molecular Formula | C30H27BrN3OP |
| Molecular Weight | 556.44 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 1-(1H-benzimidazol-2-ylmethyl)-3-[bromo(triphenyl)-λ5-phosphanyl]pyrrolidin-2-one |
| SMILES | O=C1C(P(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)CCN1Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C30H27BrN3OP/c31-36(23-12-4-1-5-13-23,24-14-6-2-7-15-24,25-16-8-3-9-17-25)28-20-21-34(30(28)35)22-29-32-26-18-10-11-19-27(26)33-29/h1-19,28H,20-22H2,(H,32,33) |
| InChIKey | IAGZUEWWTASVMJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|