C15H13NO2S — CID 54923100
N-[2-(4-hydroxybut-1-ynyl)phenyl]thiophene-3-carboxamide (PubChem CID 54923100) has the molecular formula C15H13NO2S and a molecular weight of 271.34 g/mol. Its IUPAC name is N-[2-(4-hydroxybut-1-ynyl)phenyl]thiophene-3-carboxamide.
| Compound Name | N-[2-(4-hydroxybut-1-ynyl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 54923100 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | N-[2-(4-hydroxybut-1-ynyl)phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C#CCCO)c1ccsc1 |
| InChI | InChI=1S/C15H13NO2S/c17-9-4-3-6-12-5-1-2-7-14(12)16-15(18)13-8-10-19-11-13/h1-2,5,7-8,10-11,17H,4,9H2,(H,16,18) |
| InChIKey | ZLEJZPVHSVECNG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|