C16H15NO2S — CID 60803179
N-[2-(4-hydroxybut-1-ynyl)phenyl]-5-methylthiophene-2-carboxamide (PubChem CID 60803179) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is N-[2-(4-hydroxybut-1-ynyl)phenyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[2-(4-hydroxybut-1-ynyl)phenyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60803179 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-[2-(4-hydroxybut-1-ynyl)phenyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2C#CCCO)s1 |
| InChI | InChI=1S/C16H15NO2S/c1-12-9-10-15(20-12)16(19)17-14-8-3-2-6-13(14)7-4-5-11-18/h2-3,6,8-10,18H,5,11H2,1H3,(H,17,19) |
| InChIKey | DZTDXSDGJIBUHD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|