C12H15F3N2O2 — CID 54925555
3-[propan-2-yl-[3-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid (PubChem CID 54925555) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 3-[propan-2-yl-[3-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid.
| Compound Name | 3-[propan-2-yl-[3-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54925555 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-[propan-2-yl-[3-(trifluoromethyl)-2-pyridinyl]amino]propanoic acid |
| SMILES | CC(C)N(CCC(=O)O)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c1-8(2)17(7-5-10(18)19)11-9(12(13,14)15)4-3-6-16-11/h3-4,6,8H,5,7H2,1-2H3,(H,18,19) |
| InChIKey | HASFQWGKCNXLDM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |