3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride

C13H15ClN2O2S — CID 54929599

IUPAC3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride
SMILESCc1nn(CCc2ccccc2)c(C)c1S(=O)(=O)Cl
InChIInChI=1S/C13H15ClN2O2S/c1-10-13(19(14,17)18)11(2)16(15-10)9-8-12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3
InChIKeyUFBINXCMEBZXDV-UHFFFAOYSA-N
MW298.79 g/mol
LogP2.67
Rot. Bonds4

About 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride

3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride (PubChem CID 54929599) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.79 g/mol. Its IUPAC name is 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride.

Molecular Properties

Compound Name3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride
PubChem CID54929599
Molecular FormulaC13H15ClN2O2S
Molecular Weight298.79 g/mol
Exact Mass298.05
IUPAC Name3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride
SMILESCc1nn(CCc2ccccc2)c(C)c1S(=O)(=O)Cl
InChIInChI=1S/C13H15ClN2O2S/c1-10-13(19(14,17)18)11(2)16(15-10)9-8-12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3
InChIKeyUFBINXCMEBZXDV-UHFFFAOYSA-N
XLogP2.67
TPSA51.96 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.79
LogP ≤ 52.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride?
The IUPAC name of 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride (CID 54929599) is 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride.
What is the SMILES notation for 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride?
The canonical SMILES for 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride is Cc1nn(CCc2ccccc2)c(C)c1S(=O)(=O)Cl.
What is the InChIKey of 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride?
The InChIKey is UFBINXCMEBZXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O2S/c1-10-13(19(14,17)18)11(2)16(15-10)9-8-12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3.
What are the key properties of 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride?
3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride has a molecular weight of 298.79 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride is sourced from PubChem (CID 54929599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).