C13H15ClN2O2S — CID 54929599
3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride (PubChem CID 54929599) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.79 g/mol. Its IUPAC name is 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride.
| Compound Name | 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 54929599 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3,5-dimethyl-1-(2-phenylethyl)pyrazole-4-sulfonyl chloride |
| SMILES | Cc1nn(CCc2ccccc2)c(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H15ClN2O2S/c1-10-13(19(14,17)18)11(2)16(15-10)9-8-12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3 |
| InChIKey | UFBINXCMEBZXDV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |