C11H20N4O2S — CID 54930098
5-methyl-N-(2-piperidin-3-ylethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 54930098) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 5-methyl-N-(2-piperidin-3-ylethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-N-(2-piperidin-3-ylethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 54930098 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5-methyl-N-(2-piperidin-3-ylethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCCC1CCCNC1 |
| InChI | InChI=1S/C11H20N4O2S/c1-9-11(8-13-15-9)18(16,17)14-6-4-10-3-2-5-12-7-10/h8,10,12,14H,2-7H2,1H3,(H,13,15) |
| InChIKey | IJIGQJJMZMMNMX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |