C14H19NO3S — CID 54932533
2-(4-propan-2-yloxyphenyl)-1,3-thiazinane-4-carboxylic acid (PubChem CID 54932533) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-(4-propan-2-yloxyphenyl)-1,3-thiazinane-4-carboxylic acid.
| Compound Name | 2-(4-propan-2-yloxyphenyl)-1,3-thiazinane-4-carboxylic acid |
|---|---|
| PubChem CID | 54932533 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-(4-propan-2-yloxyphenyl)-1,3-thiazinane-4-carboxylic acid |
| SMILES | CC(C)Oc1ccc(C2NC(C(=O)O)CCS2)cc1 |
| InChI | InChI=1S/C14H19NO3S/c1-9(2)18-11-5-3-10(4-6-11)13-15-12(14(16)17)7-8-19-13/h3-6,9,12-13,15H,7-8H2,1-2H3,(H,16,17) |
| InChIKey | WBVBLKNOGWFODF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |