C10H16GeO2 — CID 549385
1,1'-dimethyl-3,3'-spirobi[6-oxa-3-germabicyclo[3.1.0]hexane] (PubChem CID 549385) has the molecular formula C10H16GeO2 and a molecular weight of 240.85 g/mol. Its IUPAC name is 1,1'-dimethyl-3,3'-spirobi[6-oxa-3-germabicyclo[3.1.0]hexane].
| Compound Name | 1,1'-dimethyl-3,3'-spirobi[6-oxa-3-germabicyclo[3.1.0]hexane] |
|---|---|
| PubChem CID | 549385 |
| Molecular Formula | C10H16GeO2 |
| Molecular Weight | 240.85 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 1,1'-dimethyl-3,3'-spirobi[6-oxa-3-germabicyclo[3.1.0]hexane] |
| SMILES | CC12C[Ge]3(CC1O2)CC1OC1(C)C3 |
| InChI | InChI=1S/C10H16GeO2/c1-9-5-11(3-7(9)12-9)4-8-10(2,6-11)13-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | RERDYXYMLKYEDT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.85 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|