C17H27ClO2 — CID 59720752
3-[1-chloro-2-(1-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)propan-2-yl]-1-methyl-7-oxabicyclo[4.1.0]heptane (PubChem CID 59720752) has the molecular formula C17H27ClO2 and a molecular weight of 298.85 g/mol. Its IUPAC name is 3-[1-chloro-2-(1-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)propan-2-yl]-1-methyl-7-oxabicyclo[4.1.0]heptane.
| Compound Name | 3-[1-chloro-2-(1-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)propan-2-yl]-1-methyl-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 59720752 |
| Molecular Formula | C17H27ClO2 |
| Molecular Weight | 298.85 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-[1-chloro-2-(1-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)propan-2-yl]-1-methyl-7-oxabicyclo[4.1.0]heptane |
| SMILES | CC12CC(C(C)(CCl)C3CCC4OC4(C)C3)CCC1O2 |
| InChI | InChI=1S/C17H27ClO2/c1-15(10-18,11-4-6-13-16(2,8-11)19-13)12-5-7-14-17(3,9-12)20-14/h11-14H,4-10H2,1-3H3 |
| InChIKey | XJQOQMDHODNYGJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.85 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|