C13H21NO3 — CID 54943043
methyl 4-[(2-cyclopent-2-en-1-ylacetyl)-methylamino]butanoate (PubChem CID 54943043) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is methyl 4-[(2-cyclopent-2-en-1-ylacetyl)-methylamino]butanoate.
| Compound Name | methyl 4-[(2-cyclopent-2-en-1-ylacetyl)-methylamino]butanoate |
|---|---|
| PubChem CID | 54943043 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | methyl 4-[(2-cyclopent-2-en-1-ylacetyl)-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)CC1C=CCC1 |
| InChI | InChI=1S/C13H21NO3/c1-14(9-5-8-13(16)17-2)12(15)10-11-6-3-4-7-11/h3,6,11H,4-5,7-10H2,1-2H3 |
| InChIKey | FGVFHRHSSQWBCR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|