About 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide
3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide (PubChem CID 54945692) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide |
| PubChem CID | 54945692 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide |
| SMILES | Cc1cc2ncn(C(C)C/C(N)=N/O)c2cc1C |
| InChI | InChI=1S/C13H18N4O/c1-8-4-11-12(5-9(8)2)17(7-15-11)10(3)6-13(14)16-18/h4-5,7,10,18H,6H2,1-3H3,(H2,14,16) |
| InChIKey | ACANECNJJMASRK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide?
The IUPAC name of 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide (CID 54945692) is 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide.
What is the SMILES notation for 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide?
The canonical SMILES for 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide is Cc1cc2ncn(C(C)C/C(N)=N/O)c2cc1C.
What is the InChIKey of 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide?
The InChIKey is ACANECNJJMASRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O/c1-8-4-11-12(5-9(8)2)17(7-15-11)10(3)6-13(14)16-18/h4-5,7,10,18H,6H2,1-3H3,(H2,14,16).
What are the key properties of 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide?
3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide has a molecular weight of 246.31 g/mol, XLogP of 2.35, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dimethylbenzimidazol-1-yl)-N'-hydroxybutanimidamide is sourced from PubChem (CID 54945692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).