C12H11ClN4S — CID 54954353
5-amino-2-[1-(5-chlorothiophen-2-yl)ethylamino]pyridine-3-carbonitrile (PubChem CID 54954353) has the molecular formula C12H11ClN4S and a molecular weight of 278.77 g/mol. Its IUPAC name is 5-amino-2-[1-(5-chlorothiophen-2-yl)ethylamino]pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-[1-(5-chlorothiophen-2-yl)ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 54954353 |
| Molecular Formula | C12H11ClN4S |
| Molecular Weight | 278.77 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 5-amino-2-[1-(5-chlorothiophen-2-yl)ethylamino]pyridine-3-carbonitrile |
| SMILES | CC(Nc1ncc(N)cc1C#N)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H11ClN4S/c1-7(10-2-3-11(13)18-10)17-12-8(5-14)4-9(15)6-16-12/h2-4,6-7H,15H2,1H3,(H,16,17) |
| InChIKey | FMIXVYSVAYWCKR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.77 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |