C14H27N3O — CID 54967296
N-butyl-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)propanamide (PubChem CID 54967296) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is N-butyl-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)propanamide.
| Compound Name | N-butyl-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)propanamide |
|---|---|
| PubChem CID | 54967296 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N-butyl-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)propanamide |
| SMILES | CCCCNC(=O)C(C)NC1CCN2CCCC12 |
| InChI | InChI=1S/C14H27N3O/c1-3-4-8-15-14(18)11(2)16-12-7-10-17-9-5-6-13(12)17/h11-13,16H,3-10H2,1-2H3,(H,15,18) |
| InChIKey | PGFHOQCZSQHXCG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|