C14H28N2O — CID 79870432
N-butyl-2-[(2,2-dimethylcyclopentyl)amino]propanamide (PubChem CID 79870432) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is N-butyl-2-[(2,2-dimethylcyclopentyl)amino]propanamide.
| Compound Name | N-butyl-2-[(2,2-dimethylcyclopentyl)amino]propanamide |
|---|---|
| PubChem CID | 79870432 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | N-butyl-2-[(2,2-dimethylcyclopentyl)amino]propanamide |
| SMILES | CCCCNC(=O)C(C)NC1CCCC1(C)C |
| InChI | InChI=1S/C14H28N2O/c1-5-6-10-15-13(17)11(2)16-12-8-7-9-14(12,3)4/h11-12,16H,5-10H2,1-4H3,(H,15,17) |
| InChIKey | HLAWYJKSLDYSMW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|