C14H24N2O — CID 79870047
2-[(2,2-dimethylcyclohexyl)amino]-N-prop-2-ynylpropanamide (PubChem CID 79870047) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclohexyl)amino]-N-prop-2-ynylpropanamide.
| Compound Name | 2-[(2,2-dimethylcyclohexyl)amino]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 79870047 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-[(2,2-dimethylcyclohexyl)amino]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)NC1CCCCC1(C)C |
| InChI | InChI=1S/C14H24N2O/c1-5-10-15-13(17)11(2)16-12-8-6-7-9-14(12,3)4/h1,11-12,16H,6-10H2,2-4H3,(H,15,17) |
| InChIKey | PRBGHGSRIZJEAJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|