C11H18N2O5 — CID 54969400
2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl-(2-methoxyethyl)amino]acetic acid (PubChem CID 54969400) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 54969400 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-[2-(2,5-dioxopyrrolidin-1-yl)ethyl-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CCN1C(=O)CCC1=O)CC(=O)O |
| InChI | InChI=1S/C11H18N2O5/c1-18-7-6-12(8-11(16)17)4-5-13-9(14)2-3-10(13)15/h2-8H2,1H3,(H,16,17) |
| InChIKey | IPDKWWZPPURHDN-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|